C12H20F2N2O2 — CID 107479429
N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide (PubChem CID 107479429) has the molecular formula C12H20F2N2O2 and a molecular weight of 262.30 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 107479429 |
| Molecular Formula | C12H20F2N2O2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
| SMILES | O=C(C1NCC2CCCC21)N(CCO)CC(F)F |
| InChI | InChI=1S/C12H20F2N2O2/c13-10(14)7-16(4-5-17)12(18)11-9-3-1-2-8(9)6-15-11/h8-11,15,17H,1-7H2 |
| InChIKey | NJFATESFSOYKMF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |