C6H13F2N3O2 — CID 107480152
2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide (PubChem CID 107480152) has the molecular formula C6H13F2N3O2 and a molecular weight of 197.18 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide.
| Compound Name | 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 107480152 |
| Molecular Formula | C6H13F2N3O2 |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-[2,2-difluoroethyl(2-hydroxyethyl)amino]-N'-hydroxyethanimidamide |
| SMILES | NC(CN(CCO)CC(F)F)=NO |
| InChI | InChI=1S/C6H13F2N3O2/c7-5(8)3-11(1-2-12)4-6(9)10-13/h5,12-13H,1-4H2,(H2,9,10) |
| InChIKey | PCUVPGBBISQUPK-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|