C12H24F3N3O2 — CID 107480163
N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylhexanimidamide (PubChem CID 107480163) has the molecular formula C12H24F3N3O2 and a molecular weight of 299.34 g/mol. Its IUPAC name is N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylhexanimidamide.
| Compound Name | N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 107480163 |
| Molecular Formula | C12H24F3N3O2 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | N'-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylhexanimidamide |
| SMILES | CC(C)(CCCCN(CCO)CC(F)(F)F)C(N)=NO |
| InChI | InChI=1S/C12H24F3N3O2/c1-11(2,10(16)17-20)5-3-4-6-18(7-8-19)9-12(13,14)15/h19-20H,3-9H2,1-2H3,(H2,16,17) |
| InChIKey | GPGFQWYGPDSLKO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|