C10H21F2N3O — CID 107480278
4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanimidamide (PubChem CID 107480278) has the molecular formula C10H21F2N3O and a molecular weight of 237.29 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanimidamide.
| Compound Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 107480278 |
| Molecular Formula | C10H21F2N3O |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]-2,2-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCN(CCO)CC(F)F |
| InChI | InChI=1S/C10H21F2N3O/c1-10(2,9(13)14)3-4-15(5-6-16)7-8(11)12/h8,16H,3-7H2,1-2H3,(H3,13,14) |
| InChIKey | FNRJBHKUIURYNB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|