C10H19F2N3O — CID 107480282
2-[1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopropyl]ethanimidamide (PubChem CID 107480282) has the molecular formula C10H19F2N3O and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-[1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopropyl]ethanimidamide.
| Compound Name | 2-[1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopropyl]ethanimidamide |
|---|---|
| PubChem CID | 107480282 |
| Molecular Formula | C10H19F2N3O |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 2-[1-[[2,2-difluoroethyl(2-hydroxyethyl)amino]methyl]cyclopropyl]ethanimidamide |
| SMILES | [H]/N=C(\N)CC1(CN(CCO)CC(F)F)CC1 |
| InChI | InChI=1S/C10H19F2N3O/c11-8(12)6-15(3-4-16)7-10(1-2-10)5-9(13)14/h8,16H,1-7H2,(H3,13,14) |
| InChIKey | UWWRIWOBEVEDDS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|