C11H22F3N3O — CID 107480309
5-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylpentanimidamide (PubChem CID 107480309) has the molecular formula C11H22F3N3O and a molecular weight of 269.31 g/mol. Its IUPAC name is 5-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylpentanimidamide.
| Compound Name | 5-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 107480309 |
| Molecular Formula | C11H22F3N3O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 5-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylpentanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCN(CCO)CC(F)(F)F |
| InChI | InChI=1S/C11H22F3N3O/c1-10(2,9(15)16)4-3-5-17(6-7-18)8-11(12,13)14/h18H,3-8H2,1-2H3,(H3,15,16) |
| InChIKey | HPDCHVZJCQVYHG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|