C9H19F2N3O — CID 107480261
5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanimidamide (PubChem CID 107480261) has the molecular formula C9H19F2N3O and a molecular weight of 223.27 g/mol. Its IUPAC name is 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanimidamide.
| Compound Name | 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanimidamide |
|---|---|
| PubChem CID | 107480261 |
| Molecular Formula | C9H19F2N3O |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 5-[2,2-difluoroethyl(2-hydroxyethyl)amino]pentanimidamide |
| SMILES | [H]/N=C(\N)CCCCN(CCO)CC(F)F |
| InChI | InChI=1S/C9H19F2N3O/c10-8(11)7-14(5-6-15)4-2-1-3-9(12)13/h8,15H,1-7H2,(H3,12,13) |
| InChIKey | NQLGBGRHCZOKFY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|