C12H24F3N3O — CID 107480302
6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylhexanimidamide (PubChem CID 107480302) has the molecular formula C12H24F3N3O and a molecular weight of 283.34 g/mol. Its IUPAC name is 6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylhexanimidamide.
| Compound Name | 6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 107480302 |
| Molecular Formula | C12H24F3N3O |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylhexanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCCN(CCO)CC(F)(F)F |
| InChI | InChI=1S/C12H24F3N3O/c1-11(2,10(16)17)5-3-4-6-18(7-8-19)9-12(13,14)15/h19H,3-9H2,1-2H3,(H3,16,17) |
| InChIKey | JIKOUMPWUUBQKW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|