C12H13F3N2O3 — CID 107481112
3-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-1,3-dihydroindol-2-one (PubChem CID 107481112) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is 3-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-1,3-dihydroindol-2-one.
| Compound Name | 3-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 107481112 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-hydroxy-6-[2-hydroxyethyl(2,2,2-trifluoroethyl)amino]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(N(CCO)CC(F)(F)F)ccc2C1O |
| InChI | InChI=1S/C12H13F3N2O3/c13-12(14,15)6-17(3-4-18)7-1-2-8-9(5-7)16-11(20)10(8)19/h1-2,5,10,18-19H,3-4,6H2,(H,16,20) |
| InChIKey | OYOWWCQGZZRXNT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|