About 2-[2-azidoethyl(2,2-difluoroethyl)amino]ethanol
2-[2-azidoethyl(2,2-difluoroethyl)amino]ethanol (PubChem CID 107484809) has the molecular formula C6H12F2N4O
and a molecular weight of 194.18 g/mol. Its IUPAC name is 2-[2-azidoethyl(2,2-difluoroethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[2-azidoethyl(2,2-difluoroethyl)amino]ethanol |
| PubChem CID | 107484809 |
| Molecular Formula | C6H12F2N4O |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 2-[2-azidoethyl(2,2-difluoroethyl)amino]ethanol |
| SMILES | [N-]=[N+]=NCCN(CCO)CC(F)F |
| InChI | InChI=1S/C6H12F2N4O/c7-6(8)5-12(3-4-13)2-1-10-11-9/h6,13H,1-5H2 |
| InChIKey | HQRFSMVWKOEXNW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-azidoethyl(2,2-difluoroethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-azidoethyl(2,2-difluoroethyl)amino]ethanol?
The IUPAC name of 2-[2-azidoethyl(2,2-difluoroethyl)amino]ethanol (CID 107484809) is 2-[2-azidoethyl(2,2-difluoroethyl)amino]ethanol.
What is the SMILES notation for 2-[2-azidoethyl(2,2-difluoroethyl)amino]ethanol?
The canonical SMILES for 2-[2-azidoethyl(2,2-difluoroethyl)amino]ethanol is [N-]=[N+]=NCCN(CCO)CC(F)F.
What is the InChIKey of 2-[2-azidoethyl(2,2-difluoroethyl)amino]ethanol?
The InChIKey is HQRFSMVWKOEXNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12F2N4O/c7-6(8)5-12(3-4-13)2-1-10-11-9/h6,13H,1-5H2.
What are the key properties of 2-[2-azidoethyl(2,2-difluoroethyl)amino]ethanol?
2-[2-azidoethyl(2,2-difluoroethyl)amino]ethanol has a molecular weight of 194.18 g/mol, XLogP of 0.86, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-azidoethyl(2,2-difluoroethyl)amino]ethanol is sourced from PubChem (CID 107484809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).