C8H13F2N3O2 — CID 107485154
N-(cyanomethyl)-2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetamide (PubChem CID 107485154) has the molecular formula C8H13F2N3O2 and a molecular weight of 221.21 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetamide.
| Compound Name | N-(cyanomethyl)-2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetamide |
|---|---|
| PubChem CID | 107485154 |
| Molecular Formula | C8H13F2N3O2 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N-(cyanomethyl)-2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetamide |
| SMILES | N#CCNC(=O)CN(CCO)CC(F)F |
| InChI | InChI=1S/C8H13F2N3O2/c9-7(10)5-13(3-4-14)6-8(15)12-2-1-11/h7,14H,2-6H2,(H,12,15) |
| InChIKey | SFKWQFHQSQKLGI-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|