C9H19F2NOS — CID 107485382
2-[2,2-difluoroethyl(3-ethylsulfanylpropyl)amino]ethanol (PubChem CID 107485382) has the molecular formula C9H19F2NOS and a molecular weight of 227.32 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl(3-ethylsulfanylpropyl)amino]ethanol.
| Compound Name | 2-[2,2-difluoroethyl(3-ethylsulfanylpropyl)amino]ethanol |
|---|---|
| PubChem CID | 107485382 |
| Molecular Formula | C9H19F2NOS |
| Molecular Weight | 227.32 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-[2,2-difluoroethyl(3-ethylsulfanylpropyl)amino]ethanol |
| SMILES | CCSCCCN(CCO)CC(F)F |
| InChI | InChI=1S/C9H19F2NOS/c1-2-14-7-3-4-12(5-6-13)8-9(10)11/h9,13H,2-8H2,1H3 |
| InChIKey | WWQHFPVDUMBPOO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|