C11H19ClF7NOS — CID 157095726
[2-hydroxy-3-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfanylpropyl]-trimethylazanium chloride (PubChem CID 157095726) has the molecular formula C11H19ClF7NOS and a molecular weight of 381.79 g/mol. Its IUPAC name is [2-hydroxy-3-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfanylpropyl]-trimethylazanium chloride.
| Compound Name | [2-hydroxy-3-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfanylpropyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 157095726 |
| Molecular Formula | C11H19ClF7NOS |
| Molecular Weight | 381.79 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | [2-hydroxy-3-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfanylpropyl]-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CC(O)CSCCC(F)(C(F)(F)F)C(F)(F)F.[Cl-] |
| InChI | InChI=1S/C11H19F7NOS.ClH/c1-19(2,3)6-8(20)7-21-5-4-9(12,10(13,14)15)11(16,17)18;/h8,20H,4-7H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | VFLVVYPBSNGVRW-UHFFFAOYSA-M |
| XLogP | 0.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.79 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|