C16H18N2O — CID 107487504
3-phenyl-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]prop-2-ynamide (PubChem CID 107487504) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-phenyl-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]prop-2-ynamide.
| Compound Name | 3-phenyl-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]prop-2-ynamide |
|---|---|
| PubChem CID | 107487504 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3-phenyl-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]prop-2-ynamide |
| SMILES | O=C(C#Cc1ccccc1)NCCC1=CCNCC1 |
| InChI | InChI=1S/C16H18N2O/c19-16(7-6-14-4-2-1-3-5-14)18-13-10-15-8-11-17-12-9-15/h1-5,8,17H,9-13H2,(H,18,19) |
| InChIKey | ZTVQDUHCAXBQFO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|