C13H17BrN2O2S — CID 107488204
3-bromo-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]benzenesulfonamide (PubChem CID 107488204) has the molecular formula C13H17BrN2O2S and a molecular weight of 345.26 g/mol. Its IUPAC name is 3-bromo-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-bromo-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 107488204 |
| Molecular Formula | C13H17BrN2O2S |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 3-bromo-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCC1=CCNCC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H17BrN2O2S/c14-12-2-1-3-13(10-12)19(17,18)16-9-6-11-4-7-15-8-5-11/h1-4,10,15-16H,5-9H2 |
| InChIKey | JTRIDISEYOTNAO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|