C15H16F3N3 — CID 107488975
4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]-2-(trifluoromethyl)benzonitrile (PubChem CID 107488975) has the molecular formula C15H16F3N3 and a molecular weight of 295.31 g/mol. Its IUPAC name is 4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 107488975 |
| Molecular Formula | C15H16F3N3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 4-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethylamino]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(NCCC2=CCNCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C15H16F3N3/c16-15(17,18)14-9-13(2-1-12(14)10-19)21-8-5-11-3-6-20-7-4-11/h1-3,9,20-21H,4-8H2 |
| InChIKey | YDRWQMVJJDVWQE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|