C13H13ClN4S — CID 107489383
6-N-[1-(5-chlorothiophen-2-yl)ethyl]-1H-indazole-5,6-diamine (PubChem CID 107489383) has the molecular formula C13H13ClN4S and a molecular weight of 292.80 g/mol. Its IUPAC name is 6-N-[1-(5-chlorothiophen-2-yl)ethyl]-1H-indazole-5,6-diamine.
| Compound Name | 6-N-[1-(5-chlorothiophen-2-yl)ethyl]-1H-indazole-5,6-diamine |
|---|---|
| PubChem CID | 107489383 |
| Molecular Formula | C13H13ClN4S |
| Molecular Weight | 292.80 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 6-N-[1-(5-chlorothiophen-2-yl)ethyl]-1H-indazole-5,6-diamine |
| SMILES | CC(Nc1cc2[nH]ncc2cc1N)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H13ClN4S/c1-7(12-2-3-13(14)19-12)17-11-5-10-8(4-9(11)15)6-16-18-10/h2-7,17H,15H2,1H3,(H,16,18) |
| InChIKey | GXEKZOOYFUUBRN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.80 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|