C15H18N4S — CID 107489454
6-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-indazole-5,6-diamine (PubChem CID 107489454) has the molecular formula C15H18N4S and a molecular weight of 286.40 g/mol. Its IUPAC name is 6-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-indazole-5,6-diamine.
| Compound Name | 6-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-indazole-5,6-diamine |
|---|---|
| PubChem CID | 107489454 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 6-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-indazole-5,6-diamine |
| SMILES | Cc1cc(C(C)Nc2cc3[nH]ncc3cc2N)c(C)s1 |
| InChI | InChI=1S/C15H18N4S/c1-8-4-12(10(3)20-8)9(2)18-15-6-14-11(5-13(15)16)7-17-19-14/h4-7,9,18H,16H2,1-3H3,(H,17,19) |
| InChIKey | ZHSBKWDHHUNCSF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|