C16H27N5 — CID 107488380
6-N-[5-(diethylamino)pentan-2-yl]-1H-indazole-5,6-diamine (PubChem CID 107488380) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is 6-N-[5-(diethylamino)pentan-2-yl]-1H-indazole-5,6-diamine.
| Compound Name | 6-N-[5-(diethylamino)pentan-2-yl]-1H-indazole-5,6-diamine |
|---|---|
| PubChem CID | 107488380 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 6-N-[5-(diethylamino)pentan-2-yl]-1H-indazole-5,6-diamine |
| SMILES | CCN(CC)CCCC(C)Nc1cc2[nH]ncc2cc1N |
| InChI | InChI=1S/C16H27N5/c1-4-21(5-2)8-6-7-12(3)19-16-10-15-13(9-14(16)17)11-18-20-15/h9-12,19H,4-8,17H2,1-3H3,(H,18,20) |
| InChIKey | SLBZPKZMOOUPID-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|