C14H16N4S — CID 107489486
6-N-(1-thiophen-2-ylpropyl)-1H-indazole-5,6-diamine (PubChem CID 107489486) has the molecular formula C14H16N4S and a molecular weight of 272.38 g/mol. Its IUPAC name is 6-N-(1-thiophen-2-ylpropyl)-1H-indazole-5,6-diamine.
| Compound Name | 6-N-(1-thiophen-2-ylpropyl)-1H-indazole-5,6-diamine |
|---|---|
| PubChem CID | 107489486 |
| Molecular Formula | C14H16N4S |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 6-N-(1-thiophen-2-ylpropyl)-1H-indazole-5,6-diamine |
| SMILES | CCC(Nc1cc2[nH]ncc2cc1N)c1cccs1 |
| InChI | InChI=1S/C14H16N4S/c1-2-11(14-4-3-5-19-14)17-13-7-12-9(6-10(13)15)8-16-18-12/h3-8,11,17H,2,15H2,1H3,(H,16,18) |
| InChIKey | PUMOINPUWAKBPG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|