C14H26N2 — CID 107489886
N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]cycloheptanamine (PubChem CID 107489886) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]cycloheptanamine.
| Compound Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]cycloheptanamine |
|---|---|
| PubChem CID | 107489886 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]cycloheptanamine |
| SMILES | C1=C(CCNC2CCCCCC2)CCNC1 |
| InChI | InChI=1S/C14H26N2/c1-2-4-6-14(5-3-1)16-12-9-13-7-10-15-11-8-13/h7,14-16H,1-6,8-12H2 |
| InChIKey | WBFHJSYVKPBSGA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|