C7H14BrF2NO3S — CID 107492779
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methoxyethanesulfonamide (PubChem CID 107492779) has the molecular formula C7H14BrF2NO3S and a molecular weight of 310.16 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methoxyethanesulfonamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methoxyethanesulfonamide |
|---|---|
| PubChem CID | 107492779 |
| Molecular Formula | C7H14BrF2NO3S |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-2-methoxyethanesulfonamide |
| SMILES | COCCS(=O)(=O)N(CCBr)CC(F)F |
| InChI | InChI=1S/C7H14BrF2NO3S/c1-14-4-5-15(12,13)11(3-2-8)6-7(9)10/h7H,2-6H2,1H3 |
| InChIKey | XQJCRTMPEKSPPM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|