C7H13F2NO2S — CID 107494885
N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-sulfanylpropanamide (PubChem CID 107494885) has the molecular formula C7H13F2NO2S and a molecular weight of 213.25 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-sulfanylpropanamide.
| Compound Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107494885 |
| Molecular Formula | C7H13F2NO2S |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)-2-sulfanylpropanamide |
| SMILES | CC(S)C(=O)N(CCO)CC(F)F |
| InChI | InChI=1S/C7H13F2NO2S/c1-5(13)7(12)10(2-3-11)4-6(8)9/h5-6,11,13H,2-4H2,1H3 |
| InChIKey | QENSMWKWWFFBOV-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|