C7H12F3NO2S — CID 107494900
N-(2-hydroxyethyl)-2-sulfanyl-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 107494900) has the molecular formula C7H12F3NO2S and a molecular weight of 231.24 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-sulfanyl-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | N-(2-hydroxyethyl)-2-sulfanyl-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 107494900 |
| Molecular Formula | C7H12F3NO2S |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | N-(2-hydroxyethyl)-2-sulfanyl-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(S)C(=O)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C7H12F3NO2S/c1-5(14)6(13)11(2-3-12)4-7(8,9)10/h5,12,14H,2-4H2,1H3 |
| InChIKey | JXYPOIVRLNHBLA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|