C7H9F2N3O4S — CID 107497760
1-[2-(difluoromethylsulfonylamino)ethyl]imidazole-4-carboxylic acid (PubChem CID 107497760) has the molecular formula C7H9F2N3O4S and a molecular weight of 269.23 g/mol. Its IUPAC name is 1-[2-(difluoromethylsulfonylamino)ethyl]imidazole-4-carboxylic acid.
| Compound Name | 1-[2-(difluoromethylsulfonylamino)ethyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107497760 |
| Molecular Formula | C7H9F2N3O4S |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 1-[2-(difluoromethylsulfonylamino)ethyl]imidazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCNS(=O)(=O)C(F)F)cn1 |
| InChI | InChI=1S/C7H9F2N3O4S/c8-7(9)17(15,16)11-1-2-12-3-5(6(13)14)10-4-12/h3-4,7,11H,1-2H2,(H,13,14) |
| InChIKey | PUXCEWSHEZXLNQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |