C10H17N3O5S — CID 107498077
1-[2-(3-methoxypropylsulfonylamino)ethyl]imidazole-4-carboxylic acid (PubChem CID 107498077) has the molecular formula C10H17N3O5S and a molecular weight of 291.33 g/mol. Its IUPAC name is 1-[2-(3-methoxypropylsulfonylamino)ethyl]imidazole-4-carboxylic acid.
| Compound Name | 1-[2-(3-methoxypropylsulfonylamino)ethyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107498077 |
| Molecular Formula | C10H17N3O5S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-[2-(3-methoxypropylsulfonylamino)ethyl]imidazole-4-carboxylic acid |
| SMILES | COCCCS(=O)(=O)NCCn1cnc(C(=O)O)c1 |
| InChI | InChI=1S/C10H17N3O5S/c1-18-5-2-6-19(16,17)12-3-4-13-7-9(10(14)15)11-8-13/h7-8,12H,2-6H2,1H3,(H,14,15) |
| InChIKey | FMPNBOKOYIZWJR-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|