C10H11ClN6O — CID 107499813
1-(2-aminoethyl)-N-(6-chloropyridazin-3-yl)imidazole-4-carboxamide (PubChem CID 107499813) has the molecular formula C10H11ClN6O and a molecular weight of 266.69 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-(6-chloropyridazin-3-yl)imidazole-4-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-(6-chloropyridazin-3-yl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 107499813 |
| Molecular Formula | C10H11ClN6O |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-(2-aminoethyl)-N-(6-chloropyridazin-3-yl)imidazole-4-carboxamide |
| SMILES | NCCn1cnc(C(=O)Nc2ccc(Cl)nn2)c1 |
| InChI | InChI=1S/C10H11ClN6O/c11-8-1-2-9(16-15-8)14-10(18)7-5-17(4-3-12)6-13-7/h1-2,5-6H,3-4,12H2,(H,14,16,18) |
| InChIKey | KJWCUQXIYRICCP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |