C11H9Cl2N3O — CID 107500964
4,5-dichloro-2-(2-methylpyrimidin-4-yl)oxyaniline (PubChem CID 107500964) has the molecular formula C11H9Cl2N3O and a molecular weight of 270.12 g/mol. Its IUPAC name is 4,5-dichloro-2-(2-methylpyrimidin-4-yl)oxyaniline.
| Compound Name | 4,5-dichloro-2-(2-methylpyrimidin-4-yl)oxyaniline |
|---|---|
| PubChem CID | 107500964 |
| Molecular Formula | C11H9Cl2N3O |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 4,5-dichloro-2-(2-methylpyrimidin-4-yl)oxyaniline |
| SMILES | Cc1nccc(Oc2cc(Cl)c(Cl)cc2N)n1 |
| InChI | InChI=1S/C11H9Cl2N3O/c1-6-15-3-2-11(16-6)17-10-5-8(13)7(12)4-9(10)14/h2-5H,14H2,1H3 |
| InChIKey | MTEMNCWUOBCQKU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|