C10H6Cl3N3O — CID 107501129
4,5-dichloro-2-(5-chloropyrimidin-2-yl)oxyaniline (PubChem CID 107501129) has the molecular formula C10H6Cl3N3O and a molecular weight of 290.54 g/mol. Its IUPAC name is 4,5-dichloro-2-(5-chloropyrimidin-2-yl)oxyaniline.
| Compound Name | 4,5-dichloro-2-(5-chloropyrimidin-2-yl)oxyaniline |
|---|---|
| PubChem CID | 107501129 |
| Molecular Formula | C10H6Cl3N3O |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 288.96 |
| IUPAC Name | 4,5-dichloro-2-(5-chloropyrimidin-2-yl)oxyaniline |
| SMILES | Nc1cc(Cl)c(Cl)cc1Oc1ncc(Cl)cn1 |
| InChI | InChI=1S/C10H6Cl3N3O/c11-5-3-15-10(16-4-5)17-9-2-7(13)6(12)1-8(9)14/h1-4H,14H2 |
| InChIKey | UPGAFJFTDZYWSY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|