About 4,5-dichloro-2-(1,3,4-thiadiazol-2-yloxy)aniline
4,5-dichloro-2-(1,3,4-thiadiazol-2-yloxy)aniline (PubChem CID 107501029) has the molecular formula C8H5Cl2N3OS
and a molecular weight of 262.12 g/mol. Its IUPAC name is 4,5-dichloro-2-(1,3,4-thiadiazol-2-yloxy)aniline.
Molecular Properties
| Compound Name | 4,5-dichloro-2-(1,3,4-thiadiazol-2-yloxy)aniline |
| PubChem CID | 107501029 |
| Molecular Formula | C8H5Cl2N3OS |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 260.95 |
| IUPAC Name | 4,5-dichloro-2-(1,3,4-thiadiazol-2-yloxy)aniline |
| SMILES | Nc1cc(Cl)c(Cl)cc1Oc1nncs1 |
| InChI | InChI=1S/C8H5Cl2N3OS/c9-4-1-6(11)7(2-5(4)10)14-8-13-12-3-15-8/h1-3H,11H2 |
| InChIKey | QFBICUUTNNEVBK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dichloro-2-(1,3,4-thiadiazol-2-yloxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-2-(1,3,4-thiadiazol-2-yloxy)aniline?
The IUPAC name of 4,5-dichloro-2-(1,3,4-thiadiazol-2-yloxy)aniline (CID 107501029) is 4,5-dichloro-2-(1,3,4-thiadiazol-2-yloxy)aniline.
What is the SMILES notation for 4,5-dichloro-2-(1,3,4-thiadiazol-2-yloxy)aniline?
The canonical SMILES for 4,5-dichloro-2-(1,3,4-thiadiazol-2-yloxy)aniline is Nc1cc(Cl)c(Cl)cc1Oc1nncs1.
What is the InChIKey of 4,5-dichloro-2-(1,3,4-thiadiazol-2-yloxy)aniline?
The InChIKey is QFBICUUTNNEVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl2N3OS/c9-4-1-6(11)7(2-5(4)10)14-8-13-12-3-15-8/h1-3H,11H2.
What are the key properties of 4,5-dichloro-2-(1,3,4-thiadiazol-2-yloxy)aniline?
4,5-dichloro-2-(1,3,4-thiadiazol-2-yloxy)aniline has a molecular weight of 262.12 g/mol, XLogP of 3.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2-(1,3,4-thiadiazol-2-yloxy)aniline is sourced from PubChem (CID 107501029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).