C9H7BrN2O2S — CID 130562818
2-(4-bromo-2-methoxyphenoxy)-1,3,4-thiadiazole (PubChem CID 130562818) has the molecular formula C9H7BrN2O2S and a molecular weight of 287.14 g/mol. Its IUPAC name is 2-(4-bromo-2-methoxyphenoxy)-1,3,4-thiadiazole.
| Compound Name | 2-(4-bromo-2-methoxyphenoxy)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 130562818 |
| Molecular Formula | C9H7BrN2O2S |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 285.94 |
| IUPAC Name | 2-(4-bromo-2-methoxyphenoxy)-1,3,4-thiadiazole |
| SMILES | COc1cc(Br)ccc1Oc1nncs1 |
| InChI | InChI=1S/C9H7BrN2O2S/c1-13-8-4-6(10)2-3-7(8)14-9-12-11-5-15-9/h2-5H,1H3 |
| InChIKey | CXBVTWVYWXYQIM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |