C12H11Cl2N3O — CID 107501668
[1-(2-aminoethyl)imidazol-4-yl]-(2,5-dichlorophenyl)methanone (PubChem CID 107501668) has the molecular formula C12H11Cl2N3O and a molecular weight of 284.15 g/mol. Its IUPAC name is [1-(2-aminoethyl)imidazol-4-yl]-(2,5-dichlorophenyl)methanone.
| Compound Name | [1-(2-aminoethyl)imidazol-4-yl]-(2,5-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 107501668 |
| Molecular Formula | C12H11Cl2N3O |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | [1-(2-aminoethyl)imidazol-4-yl]-(2,5-dichlorophenyl)methanone |
| SMILES | NCCn1cnc(C(=O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C12H11Cl2N3O/c13-8-1-2-10(14)9(5-8)12(18)11-6-17(4-3-15)7-16-11/h1-2,5-7H,3-4,15H2 |
| InChIKey | MIUVHTRKMHJZLM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |