C12H12ClN3 — CID 107502259
4-chloro-2-(2,6-dimethyl-4-pyridinyl)-6-methylpyrimidine (PubChem CID 107502259) has the molecular formula C12H12ClN3 and a molecular weight of 233.70 g/mol. Its IUPAC name is 4-chloro-2-(2,6-dimethyl-4-pyridinyl)-6-methylpyrimidine.
| Compound Name | 4-chloro-2-(2,6-dimethyl-4-pyridinyl)-6-methylpyrimidine |
|---|---|
| PubChem CID | 107502259 |
| Molecular Formula | C12H12ClN3 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 4-chloro-2-(2,6-dimethyl-4-pyridinyl)-6-methylpyrimidine |
| SMILES | Cc1cc(-c2nc(C)cc(Cl)n2)cc(C)n1 |
| InChI | InChI=1S/C12H12ClN3/c1-7-4-10(5-8(2)14-7)12-15-9(3)6-11(13)16-12/h4-6H,1-3H3 |
| InChIKey | DKWOCVDTCUHPQH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |