C12H12ClN3 — CID 107504527
5-(chloromethyl)-2-(2,6-dimethyl-4-pyridinyl)pyrimidine (PubChem CID 107504527) has the molecular formula C12H12ClN3 and a molecular weight of 233.70 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(2,6-dimethyl-4-pyridinyl)pyrimidine.
| Compound Name | 5-(chloromethyl)-2-(2,6-dimethyl-4-pyridinyl)pyrimidine |
|---|---|
| PubChem CID | 107504527 |
| Molecular Formula | C12H12ClN3 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 5-(chloromethyl)-2-(2,6-dimethyl-4-pyridinyl)pyrimidine |
| SMILES | Cc1cc(-c2ncc(CCl)cn2)cc(C)n1 |
| InChI | InChI=1S/C12H12ClN3/c1-8-3-11(4-9(2)16-8)12-14-6-10(5-13)7-15-12/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | RLUOZDSIQNDPSN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|