C11H9ClIN3 — CID 107502289
4-chloro-2-(2,6-dimethyl-4-pyridinyl)-5-iodopyrimidine (PubChem CID 107502289) has the molecular formula C11H9ClIN3 and a molecular weight of 345.57 g/mol. Its IUPAC name is 4-chloro-2-(2,6-dimethyl-4-pyridinyl)-5-iodopyrimidine.
| Compound Name | 4-chloro-2-(2,6-dimethyl-4-pyridinyl)-5-iodopyrimidine |
|---|---|
| PubChem CID | 107502289 |
| Molecular Formula | C11H9ClIN3 |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | 4-chloro-2-(2,6-dimethyl-4-pyridinyl)-5-iodopyrimidine |
| SMILES | Cc1cc(-c2ncc(I)c(Cl)n2)cc(C)n1 |
| InChI | InChI=1S/C11H9ClIN3/c1-6-3-8(4-7(2)15-6)11-14-5-9(13)10(12)16-11/h3-5H,1-2H3 |
| InChIKey | OJAUGHUIWPFPCW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|