C13H9Cl2IN2O2 — CID 66313071
4-chloro-2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-5-iodopyrimidine (PubChem CID 66313071) has the molecular formula C13H9Cl2IN2O2 and a molecular weight of 423.04 g/mol. Its IUPAC name is 4-chloro-2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-5-iodopyrimidine.
| Compound Name | 4-chloro-2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-5-iodopyrimidine |
|---|---|
| PubChem CID | 66313071 |
| Molecular Formula | C13H9Cl2IN2O2 |
| Molecular Weight | 423.04 g/mol |
| Exact Mass | 421.91 |
| IUPAC Name | 4-chloro-2-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-5-iodopyrimidine |
| SMILES | Clc1cc(-c2ncc(I)c(Cl)n2)cc2c1OCCCO2 |
| InChI | InChI=1S/C13H9Cl2IN2O2/c14-8-4-7(13-17-6-9(16)12(15)18-13)5-10-11(8)20-3-1-2-19-10/h4-6H,1-3H2 |
| InChIKey | JSIOLPKVDLZTAA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.04 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|