C8H2Cl3IN2S — CID 131186384
4-chloro-2-(2,5-dichlorothiophen-3-yl)-5-iodopyrimidine (PubChem CID 131186384) has the molecular formula C8H2Cl3IN2S and a molecular weight of 391.45 g/mol. Its IUPAC name is 4-chloro-2-(2,5-dichlorothiophen-3-yl)-5-iodopyrimidine.
| Compound Name | 4-chloro-2-(2,5-dichlorothiophen-3-yl)-5-iodopyrimidine |
|---|---|
| PubChem CID | 131186384 |
| Molecular Formula | C8H2Cl3IN2S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 389.80 |
| IUPAC Name | 4-chloro-2-(2,5-dichlorothiophen-3-yl)-5-iodopyrimidine |
| SMILES | Clc1cc(-c2ncc(I)c(Cl)n2)c(Cl)s1 |
| InChI | InChI=1S/C8H2Cl3IN2S/c9-5-1-3(7(11)15-5)8-13-2-4(12)6(10)14-8/h1-2H |
| InChIKey | CSVUBSHJNPLFFP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|