C13H8Cl5N — CID 134618418
2,6-dimethyl-4-(2,3,4,5,6-pentachlorophenyl)pyridine (PubChem CID 134618418) has the molecular formula C13H8Cl5N and a molecular weight of 355.48 g/mol. Its IUPAC name is 2,6-dimethyl-4-(2,3,4,5,6-pentachlorophenyl)pyridine.
| Compound Name | 2,6-dimethyl-4-(2,3,4,5,6-pentachlorophenyl)pyridine |
|---|---|
| PubChem CID | 134618418 |
| Molecular Formula | C13H8Cl5N |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 352.91 |
| IUPAC Name | 2,6-dimethyl-4-(2,3,4,5,6-pentachlorophenyl)pyridine |
| SMILES | Cc1cc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)cc(C)n1 |
| InChI | InChI=1S/C13H8Cl5N/c1-5-3-7(4-6(2)19-5)8-9(14)11(16)13(18)12(17)10(8)15/h3-4H,1-2H3 |
| InChIKey | YBFIRRMOVVRYHB-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|