C12H5Cl5FNO — CID 133089961
2-fluoro-6-methoxy-4-(2,3,4,5,6-pentachlorophenyl)pyridine (PubChem CID 133089961) has the molecular formula C12H5Cl5FNO and a molecular weight of 375.44 g/mol. Its IUPAC name is 2-fluoro-6-methoxy-4-(2,3,4,5,6-pentachlorophenyl)pyridine.
| Compound Name | 2-fluoro-6-methoxy-4-(2,3,4,5,6-pentachlorophenyl)pyridine |
|---|---|
| PubChem CID | 133089961 |
| Molecular Formula | C12H5Cl5FNO |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 372.88 |
| IUPAC Name | 2-fluoro-6-methoxy-4-(2,3,4,5,6-pentachlorophenyl)pyridine |
| SMILES | COc1cc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)cc(F)n1 |
| InChI | InChI=1S/C12H5Cl5FNO/c1-20-6-3-4(2-5(18)19-6)7-8(13)10(15)12(17)11(16)9(7)14/h2-3H,1H3 |
| InChIKey | ZPYKWQKNBVTHQP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|