C6H5Cl2NO — CID 59872472
2,4-dichloro-6-methoxypyridine (PubChem CID 59872472) has the molecular formula C6H5Cl2NO and a molecular weight of 178.02 g/mol. Its IUPAC name is 2,4-dichloro-6-methoxypyridine.
| Compound Name | 2,4-dichloro-6-methoxypyridine |
|---|---|
| PubChem CID | 59872472 |
| Molecular Formula | C6H5Cl2NO |
| Molecular Weight | 178.02 g/mol |
| Exact Mass | 176.97 |
| IUPAC Name | 2,4-dichloro-6-methoxypyridine |
| SMILES | COc1cc(Cl)cc(Cl)n1 |
| InChI | InChI=1S/C6H5Cl2NO/c1-10-6-3-4(7)2-5(8)9-6/h2-3H,1H3 |
| InChIKey | DHWHMXYTPKDBSY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.02 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|