C9H13ClN2O2 — CID 130632462
(1R,2R)-1-amino-1-(2-chloro-6-methoxy-4-pyridinyl)propan-2-ol (PubChem CID 130632462) has the molecular formula C9H13ClN2O2 and a molecular weight of 216.67 g/mol. Its IUPAC name is (1R,2R)-1-amino-1-(2-chloro-6-methoxy-4-pyridinyl)propan-2-ol.
| Compound Name | (1R,2R)-1-amino-1-(2-chloro-6-methoxy-4-pyridinyl)propan-2-ol |
|---|---|
| PubChem CID | 130632462 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | (1R,2R)-1-amino-1-(2-chloro-6-methoxy-4-pyridinyl)propan-2-ol |
| SMILES | COc1cc([C@@H](N)[C@@H](C)O)cc(Cl)n1 |
| InChI | InChI=1S/C9H13ClN2O2/c1-5(13)9(11)6-3-7(10)12-8(4-6)14-2/h3-5,9,13H,11H2,1-2H3/t5-,9+/m1/s1 |
| InChIKey | GEMUOZRWTJKSQW-ANLVUFKYSA-N |
| XLogP | 1.12 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|