C11H17NO2 — CID 130641890
(1R,2S)-1-amino-1-(3-methoxy-5-methylphenyl)propan-2-ol (PubChem CID 130641890) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(3-methoxy-5-methylphenyl)propan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(3-methoxy-5-methylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 130641890 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (1R,2S)-1-amino-1-(3-methoxy-5-methylphenyl)propan-2-ol |
| SMILES | COc1cc(C)cc([C@@H](N)[C@H](C)O)c1 |
| InChI | InChI=1S/C11H17NO2/c1-7-4-9(11(12)8(2)13)6-10(5-7)14-3/h4-6,8,11,13H,12H2,1-3H3/t8-,11-/m0/s1 |
| InChIKey | UUQOOMMZAUMHRB-KWQFWETISA-N |
| XLogP | 1.38 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |