C11H7Cl3N2O — CID 114070681
2-chloro-6-(3,5-dichlorophenoxy)pyridin-4-amine (PubChem CID 114070681) has the molecular formula C11H7Cl3N2O and a molecular weight of 289.55 g/mol. Its IUPAC name is 2-chloro-6-(3,5-dichlorophenoxy)pyridin-4-amine.
| Compound Name | 2-chloro-6-(3,5-dichlorophenoxy)pyridin-4-amine |
|---|---|
| PubChem CID | 114070681 |
| Molecular Formula | C11H7Cl3N2O |
| Molecular Weight | 289.55 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 2-chloro-6-(3,5-dichlorophenoxy)pyridin-4-amine |
| SMILES | Nc1cc(Cl)nc(Oc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C11H7Cl3N2O/c12-6-1-7(13)3-9(2-6)17-11-5-8(15)4-10(14)16-11/h1-5H,(H2,15,16) |
| InChIKey | MDCOZQHIEYFXAA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|