C12H14O3 — CID 10750780
(1R,3S,5S,8R,9S,10S,11S,13R)-6-methyl-2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradec-6-ene (PubChem CID 10750780) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (1R,3S,5S,8R,9S,10S,11S,13R)-6-methyl-2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradec-6-ene.
| Compound Name | (1R,3S,5S,8R,9S,10S,11S,13R)-6-methyl-2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradec-6-ene |
|---|---|
| PubChem CID | 10750780 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (1R,3S,5S,8R,9S,10S,11S,13R)-6-methyl-2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradec-6-ene |
| SMILES | CC1=C[C@@H]2O[C@@H]3O[C@@H]4O[C@H]1[C@@H]1[C@@H]4C[C@@H]3[C@H]12 |
| InChI | InChI=1S/C12H14O3/c1-4-2-7-8-5-3-6-9(8)10(4)14-12(6)15-11(5)13-7/h2,5-12H,3H2,1H3/t5-,6+,7+,8+,9-,10-,11-,12+/m1/s1 |
| InChIKey | YUDBAPNEZDQABR-ZXPBCXCBSA-N |
| XLogP | 1.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|