C18H26O4 — CID 100948213
2-[[(1R,2S,3R,6S,7R,8S)-6-(methoxymethoxy)-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]oxane (PubChem CID 100948213) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 2-[[(1R,2S,3R,6S,7R,8S)-6-(methoxymethoxy)-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]oxane.
| Compound Name | 2-[[(1R,2S,3R,6S,7R,8S)-6-(methoxymethoxy)-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]oxane |
|---|---|
| PubChem CID | 100948213 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-[[(1R,2S,3R,6S,7R,8S)-6-(methoxymethoxy)-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]oxane |
| SMILES | COCO[C@H]1C=C[C@@H](OC2CCCCO2)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C18H26O4/c1-19-11-21-14-7-8-15(22-16-4-2-3-9-20-16)18-13-6-5-12(10-13)17(14)18/h5-8,12-18H,2-4,9-11H2,1H3/t12-,13+,14+,15-,16?,17+,18-/m1/s1 |
| InChIKey | HKNMKCJXTAQMQX-OLGRXRPASA-N |
| XLogP | 2.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|