C20H36O2 — CID 71401118
2-[1-(2-ethylcyclopentyl)oct-1-en-3-yloxy]oxane (PubChem CID 71401118) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 2-[1-(2-ethylcyclopentyl)oct-1-en-3-yloxy]oxane.
| Compound Name | 2-[1-(2-ethylcyclopentyl)oct-1-en-3-yloxy]oxane |
|---|---|
| PubChem CID | 71401118 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 2-[1-(2-ethylcyclopentyl)oct-1-en-3-yloxy]oxane |
| SMILES | CCCCCC(C=CC1CCCC1CC)OC1CCCCO1 |
| InChI | InChI=1S/C20H36O2/c1-3-5-6-12-19(22-20-13-7-8-16-21-20)15-14-18-11-9-10-17(18)4-2/h14-15,17-20H,3-13,16H2,1-2H3 |
| InChIKey | CZTAWXIBXSASOI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|