C19H33FO2 — CID 59065318
2-[(1S,2R,3R,4S)-3-ethyl-4-fluoro-2-[(Z)-hept-2-enyl]cyclopentyl]oxyoxane (PubChem CID 59065318) has the molecular formula C19H33FO2 and a molecular weight of 312.47 g/mol. Its IUPAC name is 2-[(1S,2R,3R,4S)-3-ethyl-4-fluoro-2-[(Z)-hept-2-enyl]cyclopentyl]oxyoxane.
| Compound Name | 2-[(1S,2R,3R,4S)-3-ethyl-4-fluoro-2-[(Z)-hept-2-enyl]cyclopentyl]oxyoxane |
|---|---|
| PubChem CID | 59065318 |
| Molecular Formula | C19H33FO2 |
| Molecular Weight | 312.47 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 2-[(1S,2R,3R,4S)-3-ethyl-4-fluoro-2-[(Z)-hept-2-enyl]cyclopentyl]oxyoxane |
| SMILES | CCCC/C=C\C[C@@H]1[C@@H](CC)[C@@H](F)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C19H33FO2/c1-3-5-6-7-8-11-16-15(4-2)17(20)14-18(16)22-19-12-9-10-13-21-19/h7-8,15-19H,3-6,9-14H2,1-2H3/b8-7-/t15-,16-,17+,18+,19?/m1/s1 |
| InChIKey | QSGRYDKAMZVCST-YLXDQGDMSA-N |
| XLogP | 5.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|