C22H37FO4 — CID 91182440
propyl (Z)-7-[(1R,2R,3S,5S)-2-ethyl-3-fluoro-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 91182440) has the molecular formula C22H37FO4 and a molecular weight of 384.53 g/mol. Its IUPAC name is propyl (Z)-7-[(1R,2R,3S,5S)-2-ethyl-3-fluoro-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | propyl (Z)-7-[(1R,2R,3S,5S)-2-ethyl-3-fluoro-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91182440 |
| Molecular Formula | C22H37FO4 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | propyl (Z)-7-[(1R,2R,3S,5S)-2-ethyl-3-fluoro-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | CCCOC(=O)CCC/C=C\C[C@@H]1[C@@H](CC)[C@@H](F)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C22H37FO4/c1-3-14-25-21(24)12-8-6-5-7-11-18-17(4-2)19(23)16-20(18)27-22-13-9-10-15-26-22/h5,7,17-20,22H,3-4,6,8-16H2,1-2H3/b7-5-/t17-,18-,19+,20+,22?/m1/s1 |
| InChIKey | GXJNNRQQTPNMIQ-OOVYLCRXSA-N |
| XLogP | 5.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|