C21H33FO5 — CID 12073625
propan-2-yl (Z)-7-[(1R,2S,3S,5S)-3-fluoro-2-formyl-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 12073625) has the molecular formula C21H33FO5 and a molecular weight of 384.49 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2S,3S,5S)-3-fluoro-2-formyl-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2S,3S,5S)-3-fluoro-2-formyl-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 12073625 |
| Molecular Formula | C21H33FO5 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2S,3S,5S)-3-fluoro-2-formyl-5-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@@H]1[C@@H](C=O)[C@@H](F)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C21H33FO5/c1-15(2)26-20(24)10-6-4-3-5-9-16-17(14-23)18(22)13-19(16)27-21-11-7-8-12-25-21/h3,5,14-19,21H,4,6-13H2,1-2H3/b5-3-/t16-,17-,18+,19+,21?/m1/s1 |
| InChIKey | APRVACVBLIDAHO-GJHGIRJZSA-N |
| XLogP | 4.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|