C18H31FO3 — CID 59065314
[(1S,2R,3S,5S)-5-fluoro-2-[(Z)-hept-2-enyl]-3-(oxan-2-yloxy)cyclopentyl]methanol (PubChem CID 59065314) has the molecular formula C18H31FO3 and a molecular weight of 314.44 g/mol. Its IUPAC name is [(1S,2R,3S,5S)-5-fluoro-2-[(Z)-hept-2-enyl]-3-(oxan-2-yloxy)cyclopentyl]methanol.
| Compound Name | [(1S,2R,3S,5S)-5-fluoro-2-[(Z)-hept-2-enyl]-3-(oxan-2-yloxy)cyclopentyl]methanol |
|---|---|
| PubChem CID | 59065314 |
| Molecular Formula | C18H31FO3 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | [(1S,2R,3S,5S)-5-fluoro-2-[(Z)-hept-2-enyl]-3-(oxan-2-yloxy)cyclopentyl]methanol |
| SMILES | CCCC/C=C\C[C@@H]1[C@@H](CO)[C@@H](F)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C18H31FO3/c1-2-3-4-5-6-9-14-15(13-20)16(19)12-17(14)22-18-10-7-8-11-21-18/h5-6,14-18,20H,2-4,7-13H2,1H3/b6-5-/t14-,15-,16+,17+,18?/m1/s1 |
| InChIKey | XLIIADVAKXNMNM-SFVMEQFUSA-N |
| XLogP | 4.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|